| Name | diethyl 4-chlorobenzylphosphonate |
| Synonyms | NSC 202843 DIETHYL 4-CHLOROBENZYLPHOSPHATE Diethyl 4-chlorobenzylphosphonate DIETHYL 4-CHLOROBENZYLPHOSPHONATE diethyl 4-chlorobenzylphosphonate DIETHYL-(4-CHLORBENZYL)-PHOSPHONAT (4-CHLOROBENZYL)PHOSPHONIC ACID DIETHYL ESTER p-(Chlorobenzyl)phosphonic acid diethyl ester Phosphonic acid, [(4-chlorophenyl)methyl]-, diethyl ester |
| CAS | 39225-17-7 |
| EINECS | 254-365-8 |
| InChI | InChI=1/C11H16ClO3P/c1-3-14-16(13,15-4-2)9-10-5-7-11(12)8-6-10/h5-8H,3-4,9H2,1-2H3 |
| Molecular Formula | C11H16ClO3P |
| Molar Mass | 262.67 |
| Density | 1.19g/mLat 25°C(lit.) |
| Boling Point | 162°C(lit.) |
| Flash Point | 230°F |
| Vapor Presure | 7.84E-05mmHg at 25°C |
| Appearance | Liquid |
| Color | Clear colorless |
| BRN | 1346690 |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | n20/D 1.509(lit.) |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S37/39 - Wear suitable gloves and eye/face protection S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| WGK Germany | 3 |
| HS Code | 29319000 |