| Name | 4-bromo-3-methylphenol |
| Synonyms | AURORA 4271 4-Bromo-m-cresol 4-BROMO-M-CRESOL AKOS BBS-00008110 4-Bromo-3-methylphenol 4-BROMO-3-METHYLPHENOL 4-bromo-3-methylphenol Phenol, 4-bromo-3-methyl- 4-BROMO-3-METHYLPHENOLBRO7H7C 4-Bromo-3-methylphenol,4-Bromo-m-cresol |
| CAS | 14472-14-1 |
| EINECS | 238-464-3 |
| InChI | InChI=1/C7H7BrO/c1-5-4-6(9)2-3-7(5)8/h2-4,9H,1H3 |
| Molecular Formula | C7H7BrO |
| Molar Mass | 187.03 |
| Density | 1.3839 (rough estimate) |
| Melting Point | 59-61 °C (lit.) |
| Boling Point | 142-145 °C/23 mmHg (lit.) |
| Flash Point | 142-145°C/23mm |
| Vapor Presure | 0.0163mmHg at 25°C |
| Appearance | White powder |
| Color | White to off-white |
| BRN | 1859122 |
| pKa | 9.51±0.18(Predicted) |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | 1.5772 (estimate) |
| MDL | MFCD00079723 |
| Physical and Chemical Properties | Melting Point 59-61°C(lit.) boiling point 142-145 ° C 23mm Hg(lit.) flash point 142-145°C/23mm BRN 1859122 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S37/39 - Wear suitable gloves and eye/face protection |
| WGK Germany | 3 |
| HS Code | 29081990 |
| Hazard Class | IRRITANT |
| Packing Group | III |
| use | 4-bromo -3-methylphenol is a phenolic derivative and can be used as a pharmaceutical intermediate. |