| Name | 3-Phenylglutaric acid |
| Synonyms | AT-51110 Benzylsuccinic 3-phenylpentanedioate 3-PHENYLGLUTARIC ACID 3-Phenylglutaric acid 3-Phenylpentanedioic acid 3-phenylpentanedioic acid Pentanedioic acid, 3-phenyl- |
| CAS | 4165-96-2 |
| EINECS | 224-016-4 |
| InChI | InChI=1/C11H12O4/c12-10(13)6-9(7-11(14)15)8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,12,13)(H,14,15)/p-2 |
| Molecular Formula | C11H12O4 |
| Molar Mass | 208.21 |
| Density | 1.2252 (rough estimate) |
| Melting Point | 140-143 °C (lit.) |
| Boling Point | 307.4°C (rough estimate) |
| Flash Point | 185.3°C |
| Solubility | DMSO (Slightly), Methanol (Slightly) |
| Vapor Presure | 8.61E-06mmHg at 25°C |
| Appearance | Solid |
| Color | White to Off-White |
| BRN | 2052171 |
| pKa | 4.06±0.10(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Stability | Hygroscopic |
| Refractive Index | 1.5020 (estimate) |
| MDL | MFCD00002718 |
| Safety Description | S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |