| Name | DL-2-Phenylpropionic acid |
| Synonyms | dl-PPA Hydratropic acid DL-Hydratropic acid 2-PHENYLPROPINICACID 2-HENYLPROPIONIC ACID α-methyl-α-toluic acid α-phenylpropionic acid 2-Phenylpropanoic acid 2-Phenylpropionic acid 2-Phenyl propionic acid DL-2-Phenylpropionic acid (n)-2-phenylpropionic acid benzeneaceticacid,α-methyl (n)-à-methylphenylacetic acid DL-alpha-Phenylpropionic Acid Benzeneacetic acid, alpha-methyl- Benzeneacetic acid, .alpha.-methyl- |
| CAS | 492-37-5 |
| EINECS | 207-752-0 |
| InChI | InChI=1/C9H10O2/c1-7(9(10)11)8-5-3-2-4-6-8/h2-7H,1H3,(H,10,11)/t7-/m0/s1 |
| Molecular Formula | C9H10O2 |
| Molar Mass | 150.18 |
| Density | 1.1 g/mL at 25 °C (lit.) |
| Melting Point | 5 °C |
| Boling Point | 260-262 °C (lit.) |
| Flash Point | >230°F |
| Water Solubility | 10 g/L (20 ºC) |
| Solubility | 9.9g/l |
| Vapor Presure | 0.00601mmHg at 25°C |
| Appearance | Liquid |
| Color | Clear pale yellow to yellow |
| BRN | 1863558 |
| pKa | 4.34±0.10(Predicted) |
| PH | 3 (5g/l, H2O, 20℃) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | n20/D 1.522(lit.) |
| Physical and Chemical Properties | Liquid. Boiling point 260-262 ℃, relative density 1.100, refractive index 1.5220, flash point> 110 ℃. |
| Use | Used as a pharmaceutical Intermediate |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S37/39 - Wear suitable gloves and eye/face protection |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29163900 |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| Biological activity | 2-Phenylpropionic acid (2-Phenylpropionate, Hydratropic acid, α-methyl-α-toluic acid) is an intermediate of alpha-Methylstyrene (2-phenylpropylene) metabolism. |
| uses | intermediates of aryl propionic acid anti-inflammatory and analgesic drugs. Used as a pharmaceutical intermediate |
| production method | can be synthesized from phenylacetic acid or phenylacetonitrile. |