| Name | 6-Bromo-2,3-dihydro-4H-chromen-4-one |
| Synonyms | 6-BROMOCHROMANONE 6-bromochroman-4-one 6-BROMOCHROMAN-4-ONE 6-Bromo-4-chromanone 6-bromo-3,4-dihydro-2H-chromen-2-one 6-Bromo-2,3-dihydro-4H-chromen-4-one 6-broMo-3,4-dihydro-2H-1-benzopyran-2-one 6-Bromochromanone (6-Bromochroman-4-one) 4H-1-BENZOPYRAN-4-ONE, 6-BROMO-2,3-DIHYDRO- 6-Bromo-2,3-dihydro-4H-chromen-4-one 6-Bromo-4-chromanone |
| CAS | 49660-57-3 |
| EINECS | 663-717-3 |
| InChI | InChI=1/C9H7BrO2/c10-6-1-2-9-7(5-6)8(11)3-4-12-9/h1-2,5H,3-4H2 |
| InChIKey | PFLPVOXSUCCZDH-UHFFFAOYSA-N |
| Molecular Formula | C9H7BrO2 |
| Molar Mass | 227.05 |
| Density | 1.621±0.06 g/cm3(Predicted) |
| Melting Point | 77-83°C |
| Boling Point | 336.6±42.0 °C(Predicted) |
| Flash Point | 157.4°C |
| Vapor Presure | 0.000111mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Orange to Green |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.599 |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | 22 - Harmful if swallowed |
| WGK Germany | 3 |
| uses | 4-dihydrochromone is a kind of natural compound with excellent biological activity, with excellent anti-cancer, antibacterial, anti-inflammatory and anti-allergic activities and anti-platelet aggregation activities. 6-Bromo-4-dihydrochromone is its derivative and can be used as a pharmaceutical intermediate. |