| Name | 5-acetamino-2-aminobenzoic acid |
| Synonyms | 5-ACETAMIDOANTHRANILIC ACID 5-Acetamidoanthranilic acid 5-ACETYLAMINO ANTHRANILIC ACID 5-acetamino-2-aminobenzoic acid 2-AMINO-5-ACETAMIDOBENZOIC ACID 5-ACETAMIDO-2-AMINOBENZOIC ACID 5-Acetamide-2-Amino-benzoic acid 5-Acetamide-2-Amine-benzoic acid 2-Amino-5-Acetamino Benzoic Acid 5-acetamide-2-amino-benzoic acid 5-(acetylamino)-2-amino-benzoicaci 5-(acetylamino)-2-aminobenzoic acid |
| CAS | 50670-83-2 |
| EINECS | 256-702-4 |
| InChI | InChI=1/C9H10N2O3/c1-5(12)11-6-2-3-8(10)7(4-6)9(13)14/h2-4H,10H2,1H3,(H,11,12)(H,13,14) |
| Molecular Formula | C9H10N2O3 |
| Molar Mass | 194.19 |
| Density | 1.414±0.06 g/cm3(Predicted) |
| Melting Point | 230°C (dec.) |
| Boling Point | 365.8±32.0 °C(Predicted) |
| Flash Point | 175.1°C |
| Vapor Presure | 5.38E-06mmHg at 25°C |
| BRN | 2726882 |
| pKa | 1.99±0.10(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.676 |
| MDL | MFCD00060120 |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R22 - Harmful if swallowed |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| TSCA | Yes |
| EPA chemical information | information provided by: ofmpub.epa.gov (external link) |