| Name | Indole-3-acetic hydrazide |
| Synonyms | INDOLE 3-ACETHYDRAZIDE Indole-3-acetic hydrazide 1-(3-Indolylacetyl)hydrazine 1-(3-indolylacetyl)-hydrazin 3-Indolylacetic acid hydrazide INDOLE-3-ACETIC ACID HYDRAZIDE 2-(1H-Indol-3-yl)acetohydrazide Hydrazine, 1-(3-indolylacetyl)- 2-(1H-indol-3-yl)ethanehydrazide 1H-Indole-3-acetic acid, hydrazide 1H-Indole-3-acetic acid, hydrazide (9CI) |
| CAS | 5448-47-5 |
| EINECS | 226-672-7 |
| InChI | InChI=1/C10H11N3O/c11-13-10(14)5-7-6-12-9-4-2-1-3-8(7)9/h1-4,6,12H,5,11H2,(H,13,14) |
| Molecular Formula | C10H11N3O |
| Molar Mass | 189.21 |
| Density | 1.1654 (rough estimate) |
| Melting Point | 142-145 °C (lit.) |
| Boling Point | 324.47°C (rough estimate) |
| Flash Point | 267.1°C |
| Vapor Presure | 7.76E-11mmHg at 25°C |
| pKa | 13.23±0.18(Predicted) |
| Storage Condition | under inert gas (nitrogen or Argon) at 2–8 °C |
| Refractive Index | 1.4830 (estimate) |
| MDL | MFCD00005634 |
| Risk Codes | R22 - Harmful if swallowed R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S24/25 - Avoid contact with skin and eyes. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| WGK Germany | 3 |
| RTECS | NL3600000 |
| Hazard Class | IRRITANT |