| Name | 6-Methoxyindole-3-carboxaldehyde |
| Synonyms | AKOS JY2083124 TIMTEC-BB SBB005312 6-METHOXY-3-INDOLECARBOXALDEHYDE 6-Methoxyindole-3-carboxaldehyde 6-METHOXYINDOLE-3-CARBOXALDEHYDE 6-Methoxy-1H-indole-3-carbaldehyde 6-METHOXY-1H-INDOLE-3-CARBALDEHYDE 6-METHOXY-1H-INDOLE-3-CARBOXALDEHYDE 1H-Indole-3-carbaldehyde, 6-methoxy- 1H-indole-3-carboxaldehyde, 6-methoxy- |
| CAS | 70555-46-3 |
| InChI | InChI=1/C10H9NO2/c1-13-8-2-3-9-7(6-12)5-11-10(9)4-8/h2-6,11H,1H3 |
| Molecular Formula | C10H9NO2 |
| Molar Mass | 175.18 |
| Density | 1.273±0.06 g/cm3(Predicted) |
| Melting Point | 185 °C |
| Boling Point | 375.2±22.0 °C(Predicted) |
| Flash Point | 180.7°C |
| Vapor Presure | 7.89E-06mmHg at 25°C |
| Appearance | Solid |
| pKa | 15.73±0.30(Predicted) |
| Storage Condition | under inert gas (nitrogen or Argon) at 2-8°C |
| Refractive Index | 1.679 |
| Risk Codes | R22 - Harmful if swallowed R36 - Irritating to the eyes |
| Safety Description | 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| Hazard Class | IRRITANT |