| Name | Diphenyliodoniumhexafluoroarsenate |
| Synonyms | Diphenyliodoniumhexafluoroarsenate hexafluoro-arsenate(1-diphenyliodonium diphenyliodoniumhexafluoroarsenate(1-) |
| CAS | 62613-15-4 |
| EINECS | 263-638-0 |
| InChI | InChI=1/C12H10I.As.6FH/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;;;;;;;/h1-10H;;6*1H/q+1;+5;;;;;;/p-6 |
| Molecular Formula | C12H10I·AsF6 |
| Molar Mass | 470.021 |
| Melting Point | 130 |
| Storage Condition | Refrigerator |
| Physical and Chemical Properties | EPA Chemical Information Iodonium, diphenyl-, hexafluoroarsenate(1-) (62613-15-4) |
| Use | Uses Diphenyliodhexafluoroarsenate is an organic halide, which can be used as an intermediate in pharmaceutical synthesis. |
| Hazard Symbols | Xi - Irritant![]() |
| UN IDs | 1557 |
| Downstream Products | [[(1R)-2-(6-aMino-9H-purin-9-yl)-1-Methylethoxy]Methyl]-, Monophenylester |
Existing research has prepared diaryl iodide polyhalogenated methylal salt by reacting between diaryl iodonium disulfate and alkali metal polyhalogenated formate.
| Hazard Note | Irritant |
| Hazard Level | 6.1 |
| packaging category | II |