| Name | Solvent Blue 63 |
| Synonyms | C.I. 61520 olvent blue 63 Ceres Blue GN. Solvent Blue 63 Transparent Blue GN C.I. Solvent Blue 63 Solvent blue 63 (C.I. 61520) 1-(methylamino)-4-[(3-methylphenyl)amino]anthraquinone 1-(Methylamino)-4-(3-methylanilino)-9,10-anthraquinone 1-(Methylamino)-4-[(3-methylphenyl)amino]-9,10-anthracenedione 1-(methylamino)-4-[(3-methylphenyl)amino]anthracene-9,10-dione 9,10-Anthracenedione, 1-(methylamino)-4-((3-methylphenyl)amino)- 9,10-Anthracenedione, 1-(methylamino)-4-[(3-methylphenyl)amino]- |
| CAS | 6408-50-0 |
| EINECS | 229-059-2 |
| InChI | InChI=1/C22H18N2O2/c1-13-6-5-7-14(12-13)24-18-11-10-17(23-2)19-20(18)22(26)16-9-4-3-8-15(16)21(19)25/h3-12,23-24H,1-2H3 |
| Molecular Formula | C22H18N2O2 |
| Molar Mass | 342.39 |
| Density | 1.312±0.06 g/cm3(Predicted) |
| Boling Point | 566.4±50.0 °C(Predicted) |
| Flash Point | 199.1°C |
| Vapor Presure | 0.002Pa at 25℃ |
| Appearance | Solid:particulate/powder |
| pKa | 4.25±0.20(Predicted) |
| Refractive Index | 1.715 |
| Physical and Chemical Properties | The dye in concentrated sulfuric acid was red violet, diluted red yellow. |
| LogP | 6.5 |
| EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
| Use | transparent blue GN is used for coloring of various plastics. |
| production method | The product was obtained by condensation of 1-bromo-4-methylaminoanthraquinone and M-toluidine. The final product was obtained by filtration and drying.. |