| Name | 1-Bromo-4-n-heptylbenzene |
| Synonyms | 4-heptylbromobenzene P-BROMOHEPTYLBENZENE 4-BROMOHEPTYLBENZENE 4-N-HEPTYLBROMOBENZENE 4-n-Heptylbromobenzene 1-bromo-4-heptylbenzene 1-(4-Bromophenyl)heptane 1-(4-BROMOPHENYL)HEPTANE 1-Bromo-4-n-heptylbenzene 1-BROMO-4-N-HEPTYLBENZENE 1-Bromo-4-heptylbenzene (stabilized with Copper chip) |
| CAS | 76287-49-5 |
| InChI | InChI=1/C13H19Br/c1-2-3-4-5-6-7-12-8-10-13(14)11-9-12/h8-11H,2-7H2,1H3 |
| Molecular Formula | C13H19Br |
| Molar Mass | 255.19 |
| Density | 1.15 |
| Boling Point | 190 °C / 35mmHg |
| Flash Point | 161°C |
| Vapor Presure | 0.00246mmHg at 25°C |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.5170-1.5190 |
| TSCA | Yes |
| HS Code | 29039990 |
| use | 4-n-heptyl bromobenzene can be used as an intermediate in pharmaceutical synthesis. liquid crystal monomer synthesis raw materials; pharmaceutical synthesis raw materials |
| hazardous treatment | if 4-n-heptyl bromobenzene is inhaled, please move the patient to fresh air; If the skin is in contact with the skin, remove the contaminated clothing, rinse the skin thoroughly with soapy water and clear water, and see a doctor if you feel uncomfortable. If the eyes are in contact with clear eyes, separate the eyelids, rinse with flowing water or normal saline, and seek medical treatment immediately; if ingestion, gargle immediately, forbid vomiting, should seek medical attention immediately. |