| Name | sym-Dibenzoylhydrazine |
| Synonyms | N,N-Dibenzhydrazide NN-Dibenzoylhydrazine sym-Dibenzoylhydrazine 1,2-dibenzoyl-hydrazin N,N-Dibenzoylhydrazine 1,2-Dibenzoylhydrazine N,N'-DIBENZOYLHYDRAZINE N'-Benzoylbenzohydrazide N'-benzoylbenzohydrazide Hydrazine, 1,2-dibenzoyl- benzoicacid,2-benzoylhydrazide N2-Benzoylbenzoic acid hydrazide Dibenzoyl hydrazine (symmetrical) |
| CAS | 787-84-8 |
| EINECS | 212-329-9 |
| InChI | InChI=1/C14H12N2O2/c17-13(11-7-3-1-4-8-11)15-16-14(18)12-9-5-2-6-10-12/h1-10H,(H,15,17)(H,16,18) |
| Molecular Formula | C14H12N2O2 |
| Molar Mass | 240.26 |
| Density | 1.1613 (rough estimate) |
| Melting Point | 238-240°C(lit.) |
| Boling Point | 382.97°C (rough estimate) |
| Flash Point | 202.8°C |
| Water Solubility | very slightly in Solution of sodium hydroxide in water,Methanol |
| Vapor Presure | 1.39E-09mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Light yellow |
| pKa | 10.70±0.23(Predicted) |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | 1.6180 (estimate) |
| MDL | MFCD00003068 |
| Physical and Chemical Properties | White crystals. Melting point 238-240 °c |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R20/21 - Harmful by inhalation and in contact with skin. |
| Safety Description | S23 - Do not breathe vapour. |
| WGK Germany | 3 |
| RTECS | MV2085000 |
| TSCA | Yes |
| HS Code | 29280000 |
| EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
| Use | organic synthesis intermediates. |
| production method | is obtained by reacting benzoyl chloride with hydrazine sulfate in sodium hydroxide solution. |