| Name | 2-Fluoro-5-nitrophenylboronic acid |
| Synonyms | 3-Borono-4-fluoronitrobenzene 2-Fluoro-5-nitrophenylboronic acid 5-NITRO-2-FLUOROPHENYLBORONIC ACID 2-FLUORO-5-NITROPHENYLBORONIC ACID 2-FLUORO-5-NITROBENZENEBORONIC ACID 2-Fluoro-5-nitrobenzeneboronic acid B-(2-fluoro-5-nitrophenyl)-Boronic acid Boronic acid, B-(2-fluoro-5-nitrophenyl)- |
| CAS | 819849-20-2 |
| InChI | InChI=1/C6H5BFNO4/c8-6-2-1-4(9(12)13)3-5(6)7(10)11/h1-3,10-11H |
| Molecular Formula | C6H5BFNO4 |
| Molar Mass | 184.92 |
| Density | 1.49±0.1 g/cm3(Predicted) |
| Boling Point | 366.8±52.0 °C(Predicted) |
| Flash Point | 175.7°C |
| Water Solubility | Slightly soluble in water. |
| Vapor Presure | 5.01E-06mmHg at 25°C |
| Appearance | Powder |
| Color | White |
| pKa | 6.72±0.58(Predicted) |
| Storage Condition | under inert gas (nitrogen or Argon) at 2-8°C |
| Refractive Index | 1.548 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| Hazard Class | IRRITANT |
| introduction | 2-fluoro -5-nitrophenylboronic acid is a derivative of phenylboronic acid, which is a kind of important chemical products and is used as welding agent, multifunctional lubricant and flame retardant. it has a huge demand in the chemical industry. As a key organic synthesis intermediate, it is widely used in the fields of medicine, chemical industry and materials. |
| synthesis method | using 3-bromo -4-fluoronitrobenzene as raw material, pinacol biborate [B2(pin)2] as boron reagent, K3PO4 · 7H2O as base, in chlorine (2-dicyclohexylphosphinyl -2 ',4',6 '-triisopropyl -1, 2-fluoro-5-nitrophenylboronic acid was synthesized under the catalysis of 1'-biphenyl)[2-(2'-amino -1,1'-biphenyl)] palladium (Ⅱ)(Xphos-Pd-G2) and 2-dicyclohexylphospho -2 ',4',6'-triisopropylbiphenyl (Xphos) systems. The synthesis reaction formula is as follows: |