| Name | 1-Chloroethyl Isopropyl Carbonate |
| Synonyms | CIPC JCC-1 1-CHLOROETHYL ISOPROPYL CARBONATE 1-Chloroethyl Isopropyl Carbonate 1-Chloroethyl lsopropyl Carbonate 1-chloroethyl 1-methylethyl carbonate 1-Chloroethyl Isopropyl Carbonate (JCC-1) 1 CHLORO ETHYL ISPPROPYL CARBONATE (CEIC) CARBONIC ACID 1-CHLOROETHYL ISOPROPYL ESTER Carbonic acid, 1-chloroethyl-, 1-methyl-, ethyl ester |
| CAS | 98298-66-9 |
| EINECS | 424-590-8 |
| InChI | InChI=1/C6H11ClO3/c1-4(2)9-6(8)10-5(3)7/h4-5H,1-3H3 |
| InChIKey | XPTPAIJDVFQPJT-UHFFFAOYSA-N |
| Molecular Formula | C6H11ClO3 |
| Molar Mass | 166.6 |
| Density | 1.113±0.06 g/cm3(Predicted) |
| Boling Point | 70 °C / 15mmHg |
| Flash Point | 55.181°C |
| Vapor Presure | 1.979mmHg at 25°C |
| Appearance | clear liquid |
| Color | Colorless to Almost colorless |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Refractive Index | 1.4110-1.4150 |
| Risk Codes | R10 - Flammable R34 - Causes burns |
| Safety Description | S16 - Keep away from sources of ignition. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| UN IDs | 2920 |
| Hazard Class | 8/3 |
| Packing Group | II |
| LogP | 1.37 at 20℃ |