| Name | Isodecyl alcohol |
| Synonyms | isodecyl HSDB 616 Isodecanol nonane-1,8-diol Isodecyl alcohol Isodesyl alcohol 8-methylnonan-1-ol 8-Methylnonane-1-ol DECANOL-ISOMERENGEMISCH DECANOL MIXTURE OF ISOMERS isodecylalcohol(mixedisomers) Alcohols, C9-11-iso, C10-rich Alcohols, C9-11-iso-, C10-rich Alcohols, C9-11-iso-, C1O-rich |
| CAS | 25339-17-7 68526-85-2 |
| EINECS | 246-869-1 |
| InChI | InChI=1/C10H22O/c1-10(2)8-6-4-3-5-7-9-11/h10-11H,3-9H2,1-2H3 |
| Molecular Formula | C10H22O |
| Molar Mass | 158.28 |
| Density | 0.838g/mLat 20°C |
| Melting Point | -60°C |
| Boling Point | 215-225°C |
| Flash Point | 95°C |
| Solubility | Benzene (Sparingly), Chloroform (Slightly) |
| Vapor Presure | 0.0365mmHg at 25°C |
| Appearance | Oil |
| Color | Colourless |
| Odor | Weak alcoholic. |
| Storage Condition | Refrigerator |
| Refractive Index | n20/D 1.440 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36 - Irritating to the eyes |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| UN IDs | 3082 |
| RTECS | NR0960000 |
| Hazard Class | 9 |
| Packing Group | III |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| toxic substance data | information provided by: pubchem.ncbi.nlm.nih.gov (external link) |