| Name | Nicotinylmethylamide |
| Synonyms | bilamid BILOCID bidbilan bilizorin Nicotinylmethylamide N-hydroxymethylamide HYDROXYMETHYLNICOTINAMIDE N-Hydroxymethylnicotinamide N-(hydroxymethyl)nicotinamide N-(HYDROXYMETHYL)NICOTINAMIDE N-(hydroxymethyl)pyridine-3-carboxamide N-(HYDROXYMETHYL)-3-PYRIDINECARBOXAMIDE 3-pyridinecarboxylic acid n-hydroxymethylamide 3-Pyridinecarboxylic acid N-hydroxymethylamide |
| CAS | 3569-99-1 |
| EINECS | 222-668-4 |
| InChI | InChI=1/C7H8N2O2/c10-5-9-7(11)6-2-1-3-8-4-6/h1-4,10H,5H2,(H,9,11) |
| Molecular Formula | C7H8N2O2 |
| Molar Mass | 152.15 |
| Density | 1.262±0.06 g/cm3(Predicted) |
| Melting Point | 152-154 °C (lit.) |
| Boling Point | 427.7±25.0 °C(Predicted) |
| Flash Point | 212.5°C |
| Solubility | DMSO, Methanol |
| Vapor Presure | 4.46E-08mmHg at 25°C |
| Appearance | Solid |
| Color | White |
| Merck | 14,4833 |
| pKa | 12.22±0.46(Predicted) |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | 1.569 |
| MDL | MFCD00010437 |
| Physical and Chemical Properties | Melting point 152-154°C |
| Use | Beneficial anti-inflammatory effect, for the treatment of cholecystitis, cholangitis, infectious hepatitis and cholelithiasis, gastroduodenal enteritis, acute enteritis and other diseases |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| RTECS | QS4476500 |
| biological activity | N-(Hydroxymethyl)nicotinamide is an antimicrobial agent. |
| use | beneficial to gallbladder anti-inflammatory effect, used to treat cholecystitis, cholangitis, infectious hepatitis and cholelithiasis, gastroduodenitis, acute enteritis and other diseases |