| Name | Nizofenone |
| Synonyms | EkonN Y-9179 54533-85-6 Nizofenone Midafenone Nizofenone fumarate 2'-Chloro-2-[2-[(diethylamino)methyl]imidazol-1-yl]-5-nitrobenzophenone 1-[2-(2-Chlorobenzoyl)-4-nitrophenyl]-2-(diethylaminomethyl)-1H-imidazole (2-Chlorophenyl)[2-[2-(diethylamino)methyl]-1H-imidazol-1-y1]-5-nitmphenyl]methanone (2-Chlorophenyl)[2-[2-[(diethylamino)methyl]-1H-imidazol-1-yl]-5-nitrophenyl]methanone (2-Chlorophenyl)(2-{2-[(diethylamino)methyl]-1H-imidazol-1-yl}-5-nitrophenyl)methanone methanone, (2-chlorophenyl)[2-[2-[(diethylamino)methyl]-1H-imidazol-1-yl]-5-nitrophenyl]- |
| CAS | 54533-85-6 |
| InChI | InChI=1/C21H21ClN4O3/c1-3-24(4-2)14-20-23-11-12-25(20)19-10-9-15(26(28)29)13-17(19)21(27)16-7-5-6-8-18(16)22/h5-13H,3-4,14H2,1-2H3 |
| Molecular Formula | C21H21ClN4O3 |
| Molar Mass | 412.87 |
| Density | 1.28±0.1 g/cm3(Predicted) |
| Melting Point | 75-76° |
| Boling Point | 609.7±65.0 °C(Predicted) |
| Flash Point | 322.5°C |
| Vapor Presure | 8.3E-15mmHg at 25°C |
| pKa | 8.75±0.25(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.623 |
| Physical and Chemical Properties | Pale yellow crystals were obtained from isopropyl ether, melting point 75-76 °c. Nizofenone Fumarate: C21H21ClN4O3? C4H4O4. [54533-86-7]. Pale yellow crystals were obtained from isopropyl ether, melting point 157-158 °c. Acute toxicity LD50 male and female mice, male and female rats (mg/kg):495,504,1711,1580 oral; 62,70,63,65 intravenous injection; 270,278,1830,1629 subcutaneous injection. |