2,6-Dimethyl-4-pyridinecarbonitrile

2,6-Dimethyl-4-pyridinecarbonitrile - Names and Identifiers

Name	2,6-dimethylpyridine-4-carbonitrile
Synonyms	LSN3327554 4-Cyano-2,6-lutidine 4-CYANO-2,6-LUTIDINE 4-Cyano-2,6-dimethylpyridine 2,6-dimethyl-4-Cyanopyridine 2,6-DIMETHYL-4-CYANOPYRIDINE 2,6-Dimethylisonicotinonitrile 2,6-Dimethylpyridine-4-carbonitrile 2,6-dimethylpyridine-4-carbonitrile 2,6-Dimethyl-4-pyridinecarbonitrile 4-pyridinecarbonitrile, 2,6-dimethyl- 2-cyano-2,6-diMethyl-1,2-dihydropyridine-4-carboxylic acid
CAS	39965-81-6
InChI	InChI=1/C8H8N2/c1-6-3-8(5-9)4-7(2)10-6/h3-4H,1-2H3

2,6-Dimethyl-4-pyridinecarbonitrile - Physico-chemical Properties

Molecular Formula	C8H8N2
Molar Mass	132.16
Density	1.05
Melting Point	80-82℃
Boling Point	229℃
Flash Point	92℃
Vapor Presure	0.07mmHg at 25°C
pKa	3.30±0.10(Predicted)
Storage Condition	Inert atmosphere,Room Temperature
Refractive Index	1.525

2,6-Dimethyl-4-pyridinecarbonitrile - Risk and Safety

Risk Codes	36 - Irritating to the eyes
Safety Description	26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.
UN IDs	2811
Hazard Class	6.1
Packing Group	Ⅲ

2,6-Dimethyl-4-pyridinecarbonitrile - Introduction

2, the chemical formula is C9H10N2, is an organic compound. It has the following properties:

1. Appearance and properties: 2. It is a light yellow to orange yellow solid with a special smell.

2. Solubility: It can be dissolved in solvents such as ethanol, methanol and chloroform, and has poor solubility in water.

3. Melting point and boiling point: 2. The melting point is about 72-76 ℃, and the boiling point is about 241-242 ℃.

4. Molecular structure: It is a derivative of pyridine. In its molecular structure, one cyano group and two methyl groups are located at the 2 and 6 positions of the pyridine ring.

2, the main uses of the pill include:

1. as an organic synthesis intermediate, can be used for the synthesis of other organic compounds.

2. Used as a synthetic raw material for certain drugs in drug research and development.

3. for the synthesis of dyes and pigments.

Preparation 2, there are mainly the following methods:

1. obtained by the reaction of 2,6-lutidine and sodium cyanide.

2. It is obtained by the reaction of 2,6-lutidine and hydrogen cyanide.

When using 2, you should pay attention to the following safety information:

1. It is an organic compound, avoid direct contact with skin and eyes.

2. use should provide good ventilation conditions, avoid inhalation of its steam or dust.

3. should be stored away from the fire and oxidant.

4. If you swallow or come into contact with large amounts of 2,, seek medical assistance immediately.

Last Update：2024-04-09 18:58:34