2,6-dimethyl-4-Cyanopyridine - Names and Identifiers
Name | 2,6-dimethylpyridine-4-carbonitrile
|
Synonyms | LSN3327554 4-Cyano-2,6-lutidine 4-CYANO-2,6-LUTIDINE 4-Cyano-2,6-dimethylpyridine 2,6-dimethyl-4-Cyanopyridine 2,6-DIMETHYL-4-CYANOPYRIDINE 2,6-Dimethylisonicotinonitrile 2,6-Dimethylpyridine-4-carbonitrile 2,6-dimethylpyridine-4-carbonitrile 2,6-Dimethyl-4-pyridinecarbonitrile 4-pyridinecarbonitrile, 2,6-dimethyl- 2-cyano-2,6-diMethyl-1,2-dihydropyridine-4-carboxylic acid
|
CAS | 39965-81-6
|
InChI | InChI=1/C8H8N2/c1-6-3-8(5-9)4-7(2)10-6/h3-4H,1-2H3 |
2,6-dimethyl-4-Cyanopyridine - Physico-chemical Properties
Molecular Formula | C8H8N2
|
Molar Mass | 132.16 |
Density | 1.05 |
Melting Point | 80-82℃ |
Boling Point | 229℃ |
Flash Point | 92℃ |
Vapor Presure | 0.07mmHg at 25°C |
pKa | 3.30±0.10(Predicted) |
Storage Condition | Inert atmosphere,Room Temperature |
Refractive Index | 1.525 |
2,6-dimethyl-4-Cyanopyridine - Risk and Safety
Risk Codes | 36 - Irritating to the eyes
|
Safety Description | 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.
|
UN IDs | 2811 |
Hazard Class | 6.1 |
Packing Group | Ⅲ |
2,6-dimethyl-4-Cyanopyridine - Introduction
2, the chemical formula is C9H10N2, is an organic compound. It has the following properties:
1. Appearance and properties: 2. It is a light yellow to orange yellow solid with a special smell.
2. Solubility: It can be dissolved in solvents such as ethanol, methanol and chloroform, and has poor solubility in water.
3. Melting point and boiling point: 2. The melting point is about 72-76 ℃, and the boiling point is about 241-242 ℃.
4. Molecular structure: It is a derivative of pyridine. In its molecular structure, one cyano group and two methyl groups are located at the 2 and 6 positions of the pyridine ring.
2, the main uses of the pill include:
1. as an organic synthesis intermediate, can be used for the synthesis of other organic compounds.
2. Used as a synthetic raw material for certain drugs in drug research and development.
3. for the synthesis of dyes and pigments.
Preparation 2, there are mainly the following methods:
1. obtained by the reaction of 2,6-lutidine and sodium cyanide.
2. It is obtained by the reaction of 2,6-lutidine and hydrogen cyanide.
When using 2, you should pay attention to the following safety information:
1. It is an organic compound, avoid direct contact with skin and eyes.
2. use should provide good ventilation conditions, avoid inhalation of its steam or dust.
3. should be stored away from the fire and oxidant.
4. If you swallow or come into contact with large amounts of 2,, seek medical assistance immediately.
Last Update:2024-04-09 18:58:34