25850-22-0 - Names and Identifiers
Name | (2,2-dimethyltetrahydro-2H-pyran-4-yl)methanamine
|
Synonyms | 2,2-diMethyloxan-4-aMine 2,2-Dimethyl-4-aminotetrahydropyran 4-AMINO-2,2-DIMETHYLTETRAHYDROPYRAN 2-Dimethyltetrahydro-2H-pyran-4-ylamine 2,2-Dimethyltetrahydro-2H-pyran-4-amine (2,2-Dimethyltetrahydropyran-4-yl)amine 2,2-Dimethyltetrahydro-2H-pyran-4-ylamine 2H-Pyran-4-amine, tetrahydro-2,2-dimethyl- (2,2-dimethyltetrahydro-2H-pyran-4-yl)methanamine
|
CAS | 25850-22-0
|
InChI | InChI=1/C7H15NO/c1-7(2)5-6(8)3-4-9-7/h6H,3-5,8H2,1-2H3 |
25850-22-0 - Physico-chemical Properties
Molecular Formula | C7H15NO
|
Molar Mass | 129.2 |
Density | 0.900 |
Boling Point | 170℃ |
Flash Point | 50℃ |
Vapor Presure | 1.48mmHg at 25°C |
pKa | 9.66±0.40(Predicted) |
Storage Condition | 2-8°C(protect from light) |
Refractive Index | 1.436 |
25850-22-0 - Risk and Safety
Hazard Symbols | Xn - Harmful
|
Risk Codes | 22 - Harmful if swallowed
|
25850-22-0 - Introduction
(2,) methanamine is an organic compound with the following properties:
1. Appearance: colorless to yellowish liquid or solid.
2. Molecular formula: C8H17NO.
3. Molecular Weight: 143.23.
4. Solubility: easily soluble in water and common organic solvents.
5. Melting Point: 50-53 ℃.
(2,) the main application areas of methanamine include:
1. Chemical Synthesis: used as organic synthesis intermediates, can be used for the synthesis of drugs, pesticides and other organic compounds.
2. Chromatographic analysis: can be used as gas chromatography stationary phase or liquid chromatography mother liquor.
3. Surfactant: can be used as a solubilizer or emulsifier.
The method of preparing (2, 3) methanamine mainly includes the following steps:
1. React 2,2-dimethyltetrahydropyran with ammonia to generate (2, 3) methanamine.
(2,) methanamine safety information is as follows:
1. Avoid contact with skin and eyes, avoid inhaling its vapor.
2. Use should wear appropriate protective equipment, such as gloves, glasses and respiratory protection.
3. Operate in a well-ventilated place to avoid prolonged exposure.
4. If you accidentally touch or take it by mistake, please consult a doctor immediately and bring the packaging container or label.
Please note that the above information is for reference only. Please be careful when using and handling chemicals, and follow the relevant regulations and safety operation guidelines in your region.
Last Update:2024-04-09 21:21:28