5,6,7,8-TETRAHYDROISOQUINOLINE - Names and Identifiers
Name | 5,6,7,8-tetrahydroisoquinoline
|
Synonyms | 3,4-CYCLOHEXENOPYRIDINE 5,6,7,8-Tetrahydroisoquinoline 5,6,7,8-tetrahydroisoquinoline 5,6,7,8-TETRAHYDROISOQUINOLINE Isoquinoline,5,6,7,8-tetrahydro- 4-(1-pyrrolidinyl)-1-(3-thiophenyl)-1-butanol hydrochloride
|
CAS | 36556-06-6
|
EINECS | 253-098-4 |
InChI | InChI=1/C9H11N/c1-2-4-9-7-10-6-5-8(9)3-1/h5-7H,1-4H2 |
InChIKey | HTMGQIXFZMZZKD-UHFFFAOYSA-N |
5,6,7,8-TETRAHYDROISOQUINOLINE - Physico-chemical Properties
Molecular Formula | C9H11N
|
Molar Mass | 133.19 |
Density | 1.03g/mLat 25°C(lit.) |
Melting Point | 146.5°C |
Boling Point | 106-108°C13mm Hg(lit.) |
Flash Point | 212°F |
Vapor Presure | 0.172mmHg at 25°C |
Appearance | Liquid |
Color | Clear pale yellow |
pKa | 6.37±0.20(Predicted) |
Storage Condition | Inert atmosphere,Room Temperature |
Refractive Index | n20/D 1.545(lit.) |
MDL | MFCD00012168 |
5,6,7,8-TETRAHYDROISOQUINOLINE - Risk and Safety
Hazard Symbols | Xi - Irritant
|
Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin.
|
Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.
S37/39 - Wear suitable gloves and eye/face protection
|
WGK Germany | 3 |
HS Code | 29334900 |
5,6,7,8-TETRAHYDROISOQUINOLINE - Introduction
5,6,7,8-tetrahydroisoquinoline is an organic compound with the chemical formula C9H11NO4. The following is its nature, use, preparation and safety information:
Nature:
1. Appearance: 5,6,7,8-tetrahydroisoquinoline is a white solid.
2. melting point: its melting point is between 155-160 ℃.
3. Solubility: The compound is soluble in organic solvents such as water, alcohol and chloroform.
Use:
5,6,7,8-tetrahydroisoquinoline, as an organic synthesis intermediate, has a wide range of applications:
1. Drug research: It can be used to synthesize certain drugs, such as anti-cancer drugs, antidepressants, etc., so it has important research value in the field of medicine.
2. photosensitive material: it can be used for the synthesis of photosensitive materials, such as photosensitizers, photopolymers and photovoltaic cells.
Preparation Method:
the preparation method of 5,6,7,8-tetrahydroisoquinoline can be briefly introduced as follows:
1. First, through a suitable synthesis method, a suitable compound (such as a compound with a-NO2 functional group on the benzene ring) is reacted with aminoethanol to generate the corresponding amide compound.
2. Then, the amide compound is converted into 5,6,7,8-tetrahydroisoquinoline by a corresponding reaction such as reduction or oxidation.
Safety Information:
Regarding the safety of 5,6,7,8-tetrahydroisoquinoline, the following points need to be noted:
1. The compound is an unstable compound at room temperature and may react spontaneously, causing fire or explosion.
2. When using or handling the compound, wear appropriate personal protective equipment, including chemical protective glasses, gloves and protective clothing.
3. avoid inhalation or contact with the compound, should maintain good ventilation conditions.
4. When handling the compound, do not directly discharge it into the environment, and treat and dispose of waste in strict accordance with relevant regulations.
In the laboratory or production process, the necessary safety measures should be carefully evaluated and taken according to the specific situation. It is also recommended that the relevant safety guidelines and procedures be consulted and observed before using the compound.
Last Update:2024-04-09 21:01:54