56962-04-0
3-bromo-5-chlorophenol
CAS: 56962-04-0
Molecular Formula: C6H4BrClO
56962-04-0 - Names and Identifiers
| Name | 3-bromo-5-chlorophenol |
| Synonyms | 3-BroMo-chlorophenol 3-bromo-5-chlorophenol Phenol, 3-bromo-5-chloro- |
| CAS | 56962-04-0 |
| InChI | InChI=1/C6H4BrClO/c7-4-1-5(8)3-6(9)2-4/h1-3,9H |
56962-04-0 - Physico-chemical Properties
| Molecular Formula | C6H4BrClO |
| Molar Mass | 207.45 |
| Density | 1.6027 (rough estimate) |
| Melting Point | 66-70℃ |
| Boling Point | 256°C (rough estimate) |
| Flash Point | 110.075°C |
| Vapor Presure | 0.004-0.084Pa at 20-50℃ |
| Appearance | Solid |
| pKa | 8.04±0.10(Predicted) |
| Storage Condition | Inert atmosphere,2-8°C |
| Refractive Index | 1.5730 (estimate) |
56962-04-0 - Reference Information
| LogP | 3.2 at 25℃ and pH2 |
| surface tension | 54.7mN/m at 1g/L and 20 ℃ |
Last Update：2024-04-09 21:04:16
