98027-27-1

98027-27-1 - Names and Identifiers

Name	5-Bromo-2-thiophenecarboxylic acid hydrazide
Synonyms	5-Bromothiophene-2-carbohydrazide 5-BROMO-THIOPHENE-2-CARBOXYLIC ACID HYDR 5-BROMO-2-THIOPHENECARBOXYLIC ACID HYDRAZIDE 5-Bromo-2-thiophenecarboxylic acid hydrazide 5-BROMO-THIOPHENE-2-CARBOXYLIC ACID HYDRAZIDE 5-Bromo-thiophene-2-carboxylic acid hydrazide 2-Thiophenecarboxylic acid, 5-broMo-, hydrazide
CAS	98027-27-1
InChI	InChI=1/C5H5BrN2OS/c6-4-2-1-3(10-4)5(9)8-7/h1-2H,7H2,(H,8,9)

98027-27-1 - Physico-chemical Properties

Molecular Formula	C5H5BrN2OS
Molar Mass	221.07
Density	1.802g/cm³
Melting Point	149-151°C
Storage Condition	Room Temprature
Refractive Index	1.652

98027-27-1 - Risk and Safety

Hazard Symbols	Xi - Irritant
Risk Codes	36/37/38 - Irritating to eyes, respiratory system and skin.
Safety Description	S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection.
HS Code	29349990
Hazard Class	IRRITANT

98027-27-1 - Introduction

The hydrazide acid is an organic compound whose chemical formula is C6H5BrN2O2S. Its properties are as follows:

1. Appearance: Colorless or light yellow crystalline solid.
2. solubility: can be dissolved in some organic solvents, such as chloroform, dimethyl sulfoxide and formic acid.
3. melting point: about 198-201 ℃.

The main uses of acid hydrazide include:

1. Intermediate: It can be used as an intermediate for the synthesis of drugs, dyes and pesticides.
2. Pesticide: Due to its special structure, it can be used to synthesize some pesticides to control the growth and reproduction of pests.

Preparation Method:
The acid hydrazide can be synthesized by the following steps:

1. First, add choline chloride and hydrobromic acid in dichloromethane.
2. Keep stirring at room temperature and allow the reaction to continue for 30 minutes.
3. Then, a bromine activator (such as benzene peroxide or trifluoroacetic acid oxygen) is added to the reaction system.
4. Continue the reaction for 30 minutes until the brominated intermediate is formed.
5. Finally, the reaction is interrupted by adding thionine and benzoyl peroxide, and acid hydrazide is obtained.

Safety Information:
when handling and storing acid hydrazide, please follow the following recommendations and precautions:

1. Avoid inhalation, ingestion and skin contact. Wear chemical safety glasses, gloves and goggles during operation.
2. Operate in a well-ventilated place to prevent aerosols, dust and vapor from entering the respiratory system.
3. Avoid contact with strong oxidants and high temperatures to avoid dangerous reactions.
4. Store in a dry, cool place, avoid direct sunlight.
5. When disposing of waste, properly dispose of it in accordance with local regulations.

Last Update：2024-04-09 21:04:16