| Name | Chloronitrobenzene |
| Synonyms | Nitrochlorobenzene Chloronitrobenzene 1-chloro-2-nitrobenzene |
| CAS | 25167-93-5 |
| EINECS | 246-695-6 |
| InChI | InChI=1/C6H4ClNO2/c7-5-3-1-2-4-6(5)8(9)10/h1-4H |
| Molecular Formula | C6H4ClNO2 |
| Molar Mass | 157.555 |
| Density | 1.391g/cm3 |
| Boling Point | 245.5°C at 760 mmHg |
| Flash Point | 96.5°C |
| Vapor Presure | 0.0448mmHg at 25°C |
| Refractive Index | 1.58 |
Chloronitrobenzene is an organic compound. It is a colorless liquid with a unique aromatic odor. The following is an introduction to the properties, uses, preparation methods, and safety information of nitrochlorobenzene:
nature:
1. Nitrochlorobenzene is a non-volatile liquid that is relatively stable at room temperature.
2. It is a combustible material that can undergo combustion reactions with other organic substances and is easily reduced.
3. Low solubility, soluble in organic solvents such as ethanol, ether, and benzene, but almost insoluble in water.
Usage:
1. Nitrochlorobenzene has a wide range of applications in the chemical industry.
2. It can also be used as an oxidant in organic synthesis.
Method:
The preparation methods of nitrochlorobenzene mainly include the following: one is to react nitric acid with chlorobenzene to generate nitrochlorobenzene; Another method is to react ortho nitrochlorobenzene with chloroacetaldehyde to produce nitrochlorobenzene. The specific preparation method can be selected according to the needs.
Security information:
1. Nitrochlorobenzene is a toxic substance that is irritating and corrosive.
2. Long term or extensive exposure may cause irritation to the eyes, skin, and respiratory tract.
3. Appropriate personal protective measures must be taken when handling nitrochlorobenzene, such as wearing protective goggles, gloves, and respiratory protective equipment.
4. Avoid contact with strong oxidants or flammable materials to prevent danger.
5. Any laboratory or workplace that uses nitrochlorobenzene should comply with relevant safety regulations and operating procedures.
6. When handling or disposing of nitrochlorobenzene, appropriate safety operating procedures must be followed to ensure personal and environmental safety.