Name | 5-hydroxy-8-methoxy-4-oxo-2-phenyl-4H-chromen-7-yl beta-D-glucopyranosiduronic acid |
Synonyms | WOGONOSIDE wogonoside B-D-GLUCOPYRANOSIDURONICACID wogonin 7-O-beta-D-glucuronide Beta-D-Glucopyranosiduronic Acid BETA-D-GLUCOPYRANOSIDURONIC ACID β-D-Glucopyranosiduronic acid,5-hydroxy- 8-methoxy-4-oxo-2-phenyl-4H-1-benzopyran-7-yl 5-hydroxy-8-methoxy-4-oxo-2-phenyl-4H-chromen-7-yl beta-D-glucopyranosiduronic acid (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(5-hydroxy-8-methoxy-4-oxo-2-phenylchromen-7-yl)oxyoxane-2-carboxylic acid |
CAS | 51059-44-0 |
InChI | InChI=1/C22H20O11/c1-30-18-13(32-22-17(27)15(25)16(26)20(33-22)21(28)29)8-11(24)14-10(23)7-12(31-19(14)18)9-5-3-2-4-6-9/h2-8,15-17,20,22,24-27H,1H3,(H,28,29)/t15-,16-,17+,20-,22+/m0/s1 |
InChIKey | LNOHXHDWGCMVCO-NTKSAMNMSA-N |
Molecular Formula | C22H20O11 |
Molar Mass | 460.39 |
Density | 1.629 |
Melting Point | 226-227℃ |
Boling Point | 820.7±65.0 °C(Predicted) |
Flash Point | 288.6°C |
Solubility | Slightly soluble in 50% ethanol or methanol, almost insoluble in water and common organic solvents. |
Vapor Presure | 1.66E-28mmHg at 25°C |
Appearance | Yellow crystal |
Color | Pale Yellow |
pKa | 2.73±0.70(Predicted) |
Storage Condition | -20°C |
Sensitive | Sensitive to light |
Refractive Index | 1.693 |
MDL | MFCD08704808 |
Physical and Chemical Properties | Yellow crystalline powder, soluble in methanol, ethanol, DMSO and other organic solvents, derived from Scutellaria baicalensis. |
Hazard Symbols | Xn - Harmful![]() |
Risk Codes | 22 - Harmful if swallowed |
WGK Germany | 3 |