| Supplier Name | |
| Tel | 02888602531 |
| Mobile | 15008222507 |
| teresa850423@163.com | |
| Website | Chengdu Baishixing Science and Technology Industry Co.,Ltd |
| Product Name | DL-Homocysteinethiolactone hydrochloride |
| Synonyms | DL-Homocysteinethiol 1,4-thiolactone hydrochloride D,L-homocysteinethiolactone HCl [(3R)-2-oxo-3-thiolanyl]ammonium d,l-homocysteinthiolaktonchlorid DL-Homocysteinethiolactone hydrochloride |
| CAS | 6038-19-3 |
| EINECS | 227-923-3 |
| Chemical Formula | C4H8ClNOS |
| Molecular Weight | 153.63 |
| inchi | InChI=1/C4H7NOS.ClH/c5-3-1-2-7-4(3)6;/h3H,1-2,5H2;1H/t3-;/m1./s1 |
| Package | 25kg， |
| Price | Email to quote |
| Descriptions | |
| Last Update | 2023-04-27 18:30:20 |