| Supplier Name | |
| Tel | 02888602531 |
| Mobile | 15008222507 |
| teresa850423@163.com | |
| Website | Chengdu Baishixing Science and Technology Industry Co.,Ltd |
| Product Name | L-phenylalaninamide hcl |
| Synonyms | H-PHE-NH2 HCL H-Phe-NH2*HCl H-PHE-NH2·HCL H-Phe-NH2·HCl H-Phe-NH2 . HCl H-L-Phe-NH2*HCl PHENYLALANINE-NH2 HCL |
| CAS | 65864-22-4 |
| EINECS | |
| Chemical Formula | C9H13ClN2O |
| Molecular Weight | 200.67 |
| inchi | InChI=1/C9H12N2O.ClH/c10-8(9(11)12)6-7-4-2-1-3-5-7;/h1-5,8H,6,10H2,(H2,11,12);1H/t8-;/m0./s1 |
| Package | 25kg， |
| Price | Email to quote |
| Descriptions | |
| Last Update | 2023-04-27 18:30:20 |