| Supplier Name | |
| Tel | 02888602531 |
| Mobile | 15008222507 |
| teresa850423@163.com | |
| Website | Chengdu Baishixing Science and Technology Industry Co.,Ltd |
| Product Name | tert-Butyl glycine hydrochloride |
| Synonyms | H-Gly-OtBu.HCl H-Gly-OtBu-HCl H-Gly-OtBu·HCl TIMTEC-BB SBB003877 GLYCINE T-BUTYL ESTER HCL GLYCINE T-butyl ester HCL Glycine tert-butyl ester HCl |
| CAS | 27532-96-3 |
| EINECS | 608-108-5 |
| Chemical Formula | C6H14ClNO2 |
| Molecular Weight | 167.63 |
| inchi | InChI=1/C9H9NO/c1-7-3-4-8(6-10)5-9(7)11-2/h3-5H,1-2H3 |
| Package | 25kg， |
| Price | Email to quote |
| Descriptions | |
| Last Update | 2023-04-27 18:30:20 |