| Name | 3-Bromo-N-phenylcarbazole |
| Synonyms | N-Phenyl-3-broMocarbazole 3-Bromo-N-phenylcarbazole 3-Bromo-9-phenylcarbazole 3-Bromo-9-phenyl-carbazole 3-Bromo-11-phenylcarbazole 3-Bromo-12-phenylcarbazole 3-Bromo-10-phenylcarbazole 3-bromo-9-phenyl-9H-carbazole 3-bromo-N-phenyl-9H-carbazole |
| CAS | 1153-85-1 |
| EINECS | 805-770-9 |
| InChI | InChI=1/C18H12BrN/c19-13-10-11-18-16(12-13)15-8-4-5-9-17(15)20(18)14-6-2-1-3-7-14/h1-12H |
| InChIKey | KUBSCXXKQGDPPD-UHFFFAOYSA-N |
| Molecular Formula | C18H12BrN |
| Molar Mass | 322.2 |
| Density | 1.39 |
| Melting Point | 98 ºC |
| Boling Point | 461.7±27.0 °C(Predicted) |
| Flash Point | 233°C |
| Water Solubility | Slightly soluble in water. |
| Vapor Presure | 1.05E-08mmHg at 25°C |
| Appearance | Crystalline powder |
| Color | White to Almost white |
| Maximum wavelength(λmax) | ['352nm(CH3CN)(lit.)'] |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.672 |
| MDL | MFCD11977305 |
| introduction | 3-bromo-N-phenylcarbazole is a heterocyclic organic compound and can be used as an intermediate in synthetic materials. |
| use | important intermediates for synthesizing photoelectric materials |