| Name | 5-Bromo-2-chloronicotinic acid |
| Synonyms | 5-Bromo-2-Chloronicotinic 5-Bromo-2-chloronicotinic acid 5-BROMO-2-CHLORONICOTINIC ACID acide 5-bromo-2-chloronicotinique 5 - broMine - 2 - nicotinic acid chloride 5-bromo-2-chloropyridine-3-carboxylic acid 5-BROMO-2-CHLORO-3-PYRIDINECARBOXYLIC ACID 5-BROMO-2-CHLOROPYRIDINE-3-CARBOXYLIC ACID 3-Pyridinecarboxylic acid, 5-bromo-2-chloro- 5-Bromo-2-chloronicotinicacid5-Bromo-2-chloronicotinicacid |
| CAS | 29241-65-4 |
| InChI | InChI=1/C6H3BrClNO2/c7-3-1-4(6(10)11)5(8)9-2-3/h1-2H,(H,10,11) |
| InChIKey | UKNYSJCAGUXDOQ-UHFFFAOYSA-N |
| Molecular Formula | C6H3BrClNO2 |
| Molar Mass | 236.45 |
| Density | 1.917±0.06 g/cm3(Predicted) |
| Melting Point | 173-176°C |
| Boling Point | 345.1±42.0 °C(Predicted) |
| Flash Point | 162.5°C |
| Solubility | Soluble in methanol, and water (slightly). |
| Vapor Presure | 2.39E-05mmHg at 25°C |
| Appearance | Crystalline powder |
| pKa | 1.61±0.25(Predicted) |
| Storage Condition | Inert atmosphere,2-8°C |
| Refractive Index | 1.629 |
| MDL | MFCD03844847 |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R22 - Harmful if swallowed |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| HS Code | 29339900 |
| Hazard Note | Irritant/Keep Cold |
| Hazard Class | IRRITANT, KEEP COLD |