| Name | 2-Chloro-6-fluorobenzonitrile |
| Synonyms | AKOS BBS-00006480 LABOTEST-BB LT00159627 6-Chloro-2-Fluorobenzonitrile 2-CHLORO-6-FLUOROBENZONITRILE 2-Chloro-6-fluorobenzonitrile 2-Fluoro-6-Chlorobenzonitrile 2-fluoro-6-chlorophenyl carbonitrile |
| CAS | 668-45-1 |
| EINECS | 211-571-2 |
| InChI | InChI=1/C9H7FO2/c10-6-1-2-9-7(5-6)8(11)3-4-12-9/h1-2,5H,3-4H2 |
| Molecular Formula | C7H3ClFN |
| Molar Mass | 155.56 |
| Density | 1.3760 (estimate) |
| Melting Point | 55-59°C(lit.) |
| Boling Point | 104°C11mm Hg(lit.) |
| Flash Point | 104-105°C/11mm |
| Vapor Presure | 0.00347mmHg at 25°C |
| Appearance | Colorless crystal |
| BRN | 1940332 |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.539 |
| MDL | MFCD00001780 |
| Physical and Chemical Properties | Colorless crystals. Boiling point 104 ℃(11mmHg), melting point 56 ℃-59 ℃. |
| Risk Codes | R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S36 - Wear suitable protective clothing. |
| UN IDs | UN 3439 6.1/PG 3 |
| WGK Germany | 3 |
| HS Code | 29269095 |
| Hazard Note | Toxic |
| Hazard Class | 6.1 |
| Packing Group | III |
| chemical properties | colorless crystal. Boiling point 104 ℃(11mmHg), melting point 56 ℃-59 ℃. |
| Use | Used as an intermediate in medicine Used as an intermediate in medicine, pesticide, and liquid crystal materials |