2-amino-1-(4-nitrophenyl)propane-1,3-diol
2-amino-1-(4-nitrophenyl)propane-1,3-diol
CAS: 119-62-0
Molecular Formula: C9H12N2O4
2-amino-1-(4-nitrophenyl)propane-1,3-diol - Names and Identifiers
| Name | 2-amino-1-(4-nitrophenyl)propane-1,3-diol |
| Synonyms | NSC163951 DL-Aminodialcohol 2-Amino-3-(4-nitrophenyl)-1,3-propanediol 2-Amino-1-(4-Nitrophenyl)-1,3-Propanediol 2-amino-1-(4-nitrophenyl)propane-1,3-diol 1-(p-Nitrophenyl)-2-amino-1,3-propanediol 2-Amino-1-(4-nitrophenyl)-1,3-propanediol 1-(4'-nitrophenyl)-2-aminopropane-1,3-diol 2-Amino-1-(4-nitrophenyl)-1,3-Propanediol (DL-) D-(-)-Three-1-[4-Nitrophenyl]-2-AMino-1,3-Propanediol |
| CAS | 119-62-0 |
| EINECS | 204-338-1 |
| InChI | InChI=1/C9H12N2O4/c10-8(5-12)9(13)6-1-3-7(4-2-6)11(14)15/h1-4,8-9,12-13H,5,10H2 |
2-amino-1-(4-nitrophenyl)propane-1,3-diol - Physico-chemical Properties
| Molecular Formula | C9H12N2O4 |
| Molar Mass | 212.2 |
| Density | 1.410±0.06 g/cm3(Predicted) |
| Melting Point | 163-165 °C |
| Boling Point | 451.9±45.0 °C(Predicted) |
| Flash Point | 227.1°C |
| Vapor Presure | 5.92E-09mmHg at 25°C |
| pKa | 10.98±0.45(Predicted) |
| Refractive Index | 1.63 |
| Use | As an intermediate of chloramphenicol |
2-amino-1-(4-nitrophenyl)propane-1,3-diol - Reference Information
| NIST chemical information | information provided by: webbook.nist.gov (external link) |
| Use | for use as an intermediate of chloramphenicol |
Last Update：2024-04-09 02:00:04
