| Supplier Name | |
| Tel | 02888602531 |
| Mobile | 15008222507 |
| teresa850423@163.com | |
| Website | Chengdu Baishixing Science and Technology Industry Co.,Ltd |
| Product Name | Orotic acid |
| Synonyms | Orotic acid ai3-25478[qr] acidoorotico[qr] 6-carboxyuracil[qr] orotic acid anhydrous acideorotique(french)[qr] acidumoroticum(latin)[qr] |
| CAS | 65-86-1 |
| EINECS | 200-619-8 |
| Chemical Formula | C5H4N2O4 |
| Molecular Weight | 156.1 |
| inchi | InChI=1/C5H4N2O4/c8-3-1-2(4(9)10)6-5(11)7-3/h1H,(H,9,10)(H2,6,7,8,11) |
| Package | 25kg， |
| Price | Email to quote |
| Descriptions | |
| Last Update | 2023-04-27 18:30:20 |